C15H13ClN4S — CID 104715732
2-(2-chloroethyl)-3-[2-(1,3-thiazol-2-yl)ethyl]benzimidazole-5-carbonitrile (PubChem CID 104715732) has the molecular formula C15H13ClN4S and a molecular weight of 316.82 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-[2-(1,3-thiazol-2-yl)ethyl]benzimidazole-5-carbonitrile.
| Compound Name | 2-(2-chloroethyl)-3-[2-(1,3-thiazol-2-yl)ethyl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104715732 |
| Molecular Formula | C15H13ClN4S |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(2-chloroethyl)-3-[2-(1,3-thiazol-2-yl)ethyl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(CCCl)n(CCc3nccs3)c2c1 |
| InChI | InChI=1S/C15H13ClN4S/c16-5-3-14-19-12-2-1-11(10-17)9-13(12)20(14)7-4-15-18-6-8-21-15/h1-2,6,8-9H,3-5,7H2 |
| InChIKey | XEPIOFGZZAIVAE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|