C14H19ClFN3O — CID 63598965
1-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]-N,N-dimethylpropan-2-amine (PubChem CID 63598965) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]-N,N-dimethylpropan-2-amine.
| Compound Name | 1-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 63598965 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]-N,N-dimethylpropan-2-amine |
| SMILES | COc1cc2c(cc1F)nc(CCl)n2CC(C)N(C)C |
| InChI | InChI=1S/C14H19ClFN3O/c1-9(18(2)3)8-19-12-6-13(20-4)10(16)5-11(12)17-14(19)7-15/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | IRGNKNYXTQFNQP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|