C15H18ClFN2O2 — CID 63598792
2-(chloromethyl)-5-fluoro-6-methoxy-1-(oxan-2-ylmethyl)benzimidazole (PubChem CID 63598792) has the molecular formula C15H18ClFN2O2 and a molecular weight of 312.77 g/mol. Its IUPAC name is 2-(chloromethyl)-5-fluoro-6-methoxy-1-(oxan-2-ylmethyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-5-fluoro-6-methoxy-1-(oxan-2-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 63598792 |
| Molecular Formula | C15H18ClFN2O2 |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-(chloromethyl)-5-fluoro-6-methoxy-1-(oxan-2-ylmethyl)benzimidazole |
| SMILES | COc1cc2c(cc1F)nc(CCl)n2CC1CCCCO1 |
| InChI | InChI=1S/C15H18ClFN2O2/c1-20-14-7-13-12(6-11(14)17)18-15(8-16)19(13)9-10-4-2-3-5-21-10/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | GFMBCUASFTWIHQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|