C15H17ClN2O3 — CID 175589218
methyl 2-(chloromethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazole-5-carboxylate (PubChem CID 175589218) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is methyl 2-(chloromethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 2-(chloromethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 175589218 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | methyl 2-(chloromethyl)-1-[[(2S)-oxolan-2-yl]methyl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(CCl)n2C[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-20-15(19)10-4-5-13-12(7-10)17-14(8-16)18(13)9-11-3-2-6-21-11/h4-5,7,11H,2-3,6,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | HTRWTNAQZJMORL-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|