C16H18N2O4S — CID 7849277
methyl 2-methylsulfanyl-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazoline-7-carboxylate (PubChem CID 7849277) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is methyl 2-methylsulfanyl-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazoline-7-carboxylate.
| Compound Name | methyl 2-methylsulfanyl-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 7849277 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | methyl 2-methylsulfanyl-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(C[C@@H]3CCCO3)c(SC)nc2c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-21-15(20)10-5-6-12-13(8-10)17-16(23-2)18(14(12)19)9-11-4-3-7-22-11/h5-6,8,11H,3-4,7,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | KKACWLQDMUYBHV-NSHDSACASA-N |
| XLogP | 2.08 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |