C22H27N3O6S — CID 92707017
methyl 3-oxo-4-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-7-(propan-2-ylcarbamoyl)quinazolin-2-yl]sulfanylbutanoate (PubChem CID 92707017) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is methyl 3-oxo-4-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-7-(propan-2-ylcarbamoyl)quinazolin-2-yl]sulfanylbutanoate.
| Compound Name | methyl 3-oxo-4-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-7-(propan-2-ylcarbamoyl)quinazolin-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 92707017 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | methyl 3-oxo-4-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-7-(propan-2-ylcarbamoyl)quinazolin-2-yl]sulfanylbutanoate |
| SMILES | COC(=O)CC(=O)CSc1nc2cc(C(=O)NC(C)C)ccc2c(=O)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H27N3O6S/c1-13(2)23-20(28)14-6-7-17-18(9-14)24-22(32-12-15(26)10-19(27)30-3)25(21(17)29)11-16-5-4-8-31-16/h6-7,9,13,16H,4-5,8,10-12H2,1-3H3,(H,23,28)/t16-/m0/s1 |
| InChIKey | VXHUOEHGNIEIRR-INIZCTEOSA-N |
| XLogP | 1.94 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|