C18H24N4O3 — CID 164601697
methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-(piperazin-1-ylmethyl)benzimidazole-5-carboxylate (PubChem CID 164601697) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-(piperazin-1-ylmethyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-(piperazin-1-ylmethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 164601697 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-(piperazin-1-ylmethyl)benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(CN3CCNCC3)n(C[C@@H]3CCO3)c2c1 |
| InChI | InChI=1S/C18H24N4O3/c1-24-18(23)13-2-3-15-16(10-13)22(11-14-4-9-25-14)17(20-15)12-21-7-5-19-6-8-21/h2-3,10,14,19H,4-9,11-12H2,1H3/t14-/m0/s1 |
| InChIKey | XWWAWZLOJNIXHF-AWEZNQCLSA-N |
| XLogP | 1.02 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |