C18H19BN4O6 — CID 175246837
[1-[[6-methoxycarbonyl-1-(oxetan-2-ylmethyl)benzimidazol-2-yl]methyl]-6-oxopyridazin-4-yl]boronic acid (PubChem CID 175246837) has the molecular formula C18H19BN4O6 and a molecular weight of 398.18 g/mol. Its IUPAC name is [1-[[6-methoxycarbonyl-1-(oxetan-2-ylmethyl)benzimidazol-2-yl]methyl]-6-oxopyridazin-4-yl]boronic acid.
| Compound Name | [1-[[6-methoxycarbonyl-1-(oxetan-2-ylmethyl)benzimidazol-2-yl]methyl]-6-oxopyridazin-4-yl]boronic acid |
|---|---|
| PubChem CID | 175246837 |
| Molecular Formula | C18H19BN4O6 |
| Molecular Weight | 398.18 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [1-[[6-methoxycarbonyl-1-(oxetan-2-ylmethyl)benzimidazol-2-yl]methyl]-6-oxopyridazin-4-yl]boronic acid |
| SMILES | COC(=O)c1ccc2nc(Cn3ncc(B(O)O)cc3=O)n(CC3CCO3)c2c1 |
| InChI | InChI=1S/C18H19BN4O6/c1-28-18(25)11-2-3-14-15(6-11)22(9-13-4-5-29-13)16(21-14)10-23-17(24)7-12(8-20-23)19(26)27/h2-3,6-8,13,26-27H,4-5,9-10H2,1H3 |
| InChIKey | YHGJVGGPMRURGG-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.18 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|