C16H20ClFN2O — CID 63599299
2-(1-chloroethyl)-1-(cyclopentylmethyl)-5-fluoro-6-methoxybenzimidazole (PubChem CID 63599299) has the molecular formula C16H20ClFN2O and a molecular weight of 310.80 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(cyclopentylmethyl)-5-fluoro-6-methoxybenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(cyclopentylmethyl)-5-fluoro-6-methoxybenzimidazole |
|---|---|
| PubChem CID | 63599299 |
| Molecular Formula | C16H20ClFN2O |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-(1-chloroethyl)-1-(cyclopentylmethyl)-5-fluoro-6-methoxybenzimidazole |
| SMILES | COc1cc2c(cc1F)nc(C(C)Cl)n2CC1CCCC1 |
| InChI | InChI=1S/C16H20ClFN2O/c1-10(17)16-19-13-7-12(18)15(21-2)8-14(13)20(16)9-11-5-3-4-6-11/h7-8,10-11H,3-6,9H2,1-2H3 |
| InChIKey | NMZMKZNRCXEBBK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|