C14H15Cl2FN2O — CID 66111998
5-chloro-2-(1-chloroethyl)-6-fluoro-1-(oxolan-3-ylmethyl)benzimidazole (PubChem CID 66111998) has the molecular formula C14H15Cl2FN2O and a molecular weight of 317.19 g/mol. Its IUPAC name is 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(oxolan-3-ylmethyl)benzimidazole.
| Compound Name | 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(oxolan-3-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 66111998 |
| Molecular Formula | C14H15Cl2FN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(oxolan-3-ylmethyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(Cl)c(F)cc2n1CC1CCOC1 |
| InChI | InChI=1S/C14H15Cl2FN2O/c1-8(15)14-18-12-4-10(16)11(17)5-13(12)19(14)6-9-2-3-20-7-9/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | DMVQNPJMGKSVIW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|