C16H21Cl2FN2 — CID 83142345
5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2,3,3-trimethylbutyl)benzimidazole (PubChem CID 83142345) has the molecular formula C16H21Cl2FN2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2,3,3-trimethylbutyl)benzimidazole.
| Compound Name | 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2,3,3-trimethylbutyl)benzimidazole |
|---|---|
| PubChem CID | 83142345 |
| Molecular Formula | C16H21Cl2FN2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 5-chloro-2-(1-chloroethyl)-6-fluoro-1-(2,3,3-trimethylbutyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(Cl)c(F)cc2n1CC(C)C(C)(C)C |
| InChI | InChI=1S/C16H21Cl2FN2/c1-9(16(3,4)5)8-21-14-7-12(19)11(18)6-13(14)20-15(21)10(2)17/h6-7,9-10H,8H2,1-5H3 |
| InChIKey | ZRQLHYDEHADULI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|