C14H17Cl2FN2 — CID 114089620
6-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluorobenzimidazole (PubChem CID 114089620) has the molecular formula C14H17Cl2FN2 and a molecular weight of 303.21 g/mol. Its IUPAC name is 6-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluorobenzimidazole.
| Compound Name | 6-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluorobenzimidazole |
|---|---|
| PubChem CID | 114089620 |
| Molecular Formula | C14H17Cl2FN2 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 6-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluorobenzimidazole |
| SMILES | CC(Cl)c1nc2cc(F)c(Cl)cc2n1CC(C)(C)C |
| InChI | InChI=1S/C14H17Cl2FN2/c1-8(15)13-18-11-6-10(17)9(16)5-12(11)19(13)7-14(2,3)4/h5-6,8H,7H2,1-4H3 |
| InChIKey | YKMMRWXNKMLTJQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|