C15H20ClFN2O — CID 63597399
2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluoro-6-methoxybenzimidazole (PubChem CID 63597399) has the molecular formula C15H20ClFN2O and a molecular weight of 298.79 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluoro-6-methoxybenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluoro-6-methoxybenzimidazole |
|---|---|
| PubChem CID | 63597399 |
| Molecular Formula | C15H20ClFN2O |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(1-chloroethyl)-1-(2,2-dimethylpropyl)-5-fluoro-6-methoxybenzimidazole |
| SMILES | COc1cc2c(cc1F)nc(C(C)Cl)n2CC(C)(C)C |
| InChI | InChI=1S/C15H20ClFN2O/c1-9(16)14-18-11-6-10(17)13(20-5)7-12(11)19(14)8-15(2,3)4/h6-7,9H,8H2,1-5H3 |
| InChIKey | PRWVXRSZPFUULZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|