C13H15ClF2N2O — CID 112752136
2-(1-chloroethyl)-5,6-difluoro-1-(3-methoxypropyl)benzimidazole (PubChem CID 112752136) has the molecular formula C13H15ClF2N2O and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5,6-difluoro-1-(3-methoxypropyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5,6-difluoro-1-(3-methoxypropyl)benzimidazole |
|---|---|
| PubChem CID | 112752136 |
| Molecular Formula | C13H15ClF2N2O |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-(1-chloroethyl)-5,6-difluoro-1-(3-methoxypropyl)benzimidazole |
| SMILES | COCCCn1c(C(C)Cl)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C13H15ClF2N2O/c1-8(14)13-17-11-6-9(15)10(16)7-12(11)18(13)4-3-5-19-2/h6-8H,3-5H2,1-2H3 |
| InChIKey | AJKFMJGGBYBMRN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|