C13H12BrClF4N2 — CID 115521074
5-bromo-2-(1-chloroethyl)-6-fluoro-1-(4,4,4-trifluorobutyl)benzimidazole (PubChem CID 115521074) has the molecular formula C13H12BrClF4N2 and a molecular weight of 387.60 g/mol. Its IUPAC name is 5-bromo-2-(1-chloroethyl)-6-fluoro-1-(4,4,4-trifluorobutyl)benzimidazole.
| Compound Name | 5-bromo-2-(1-chloroethyl)-6-fluoro-1-(4,4,4-trifluorobutyl)benzimidazole |
|---|---|
| PubChem CID | 115521074 |
| Molecular Formula | C13H12BrClF4N2 |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 5-bromo-2-(1-chloroethyl)-6-fluoro-1-(4,4,4-trifluorobutyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(Br)c(F)cc2n1CCCC(F)(F)F |
| InChI | InChI=1S/C13H12BrClF4N2/c1-7(15)12-20-10-5-8(14)9(16)6-11(10)21(12)4-2-3-13(17,18)19/h5-7H,2-4H2,1H3 |
| InChIKey | KJVPLIBMVDHTCU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|