C14H15ClF3IN2 — CID 115521094
2-(1-chloroethyl)-5-iodo-1-(5,5,5-trifluoropentyl)benzimidazole (PubChem CID 115521094) has the molecular formula C14H15ClF3IN2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-iodo-1-(5,5,5-trifluoropentyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-iodo-1-(5,5,5-trifluoropentyl)benzimidazole |
|---|---|
| PubChem CID | 115521094 |
| Molecular Formula | C14H15ClF3IN2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 2-(1-chloroethyl)-5-iodo-1-(5,5,5-trifluoropentyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(I)ccc2n1CCCCC(F)(F)F |
| InChI | InChI=1S/C14H15ClF3IN2/c1-9(15)13-20-11-8-10(19)4-5-12(11)21(13)7-3-2-6-14(16,17)18/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | YNKKVSUZVBLXER-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|