C13H15ClIN3O2 — CID 106240496
2-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethoxy]acetamide (PubChem CID 106240496) has the molecular formula C13H15ClIN3O2 and a molecular weight of 407.64 g/mol. Its IUPAC name is 2-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethoxy]acetamide.
| Compound Name | 2-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240496 |
| Molecular Formula | C13H15ClIN3O2 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 2-[2-[2-(1-chloroethyl)-5-iodobenzimidazol-1-yl]ethoxy]acetamide |
| SMILES | CC(Cl)c1nc2cc(I)ccc2n1CCOCC(N)=O |
| InChI | InChI=1S/C13H15ClIN3O2/c1-8(14)13-17-10-6-9(15)2-3-11(10)18(13)4-5-20-7-12(16)19/h2-3,6,8H,4-5,7H2,1H3,(H2,16,19) |
| InChIKey | CSZSHLZIGJZXIX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|