C12H14Cl2N4O2 — CID 106240505
2-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethoxy]acetamide (PubChem CID 106240505) has the molecular formula C12H14Cl2N4O2 and a molecular weight of 317.18 g/mol. Its IUPAC name is 2-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethoxy]acetamide.
| Compound Name | 2-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240505 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[2-[6-chloro-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]ethoxy]acetamide |
| SMILES | CC(Cl)c1nc2cc(Cl)cnc2n1CCOCC(N)=O |
| InChI | InChI=1S/C12H14Cl2N4O2/c1-7(13)11-17-9-4-8(14)5-16-12(9)18(11)2-3-20-6-10(15)19/h4-5,7H,2-3,6H2,1H3,(H2,15,19) |
| InChIKey | NLNIQRCHZZQEIC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|