C13H20ClN5O2 — CID 106240657
2-[2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethoxy]acetamide (PubChem CID 106240657) has the molecular formula C13H20ClN5O2 and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-[2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethoxy]acetamide.
| Compound Name | 2-[2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240657 |
| Molecular Formula | C13H20ClN5O2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethoxy]acetamide |
| SMILES | CCc1nn(C)c2c1nc(C(C)Cl)n2CCOCC(N)=O |
| InChI | InChI=1S/C13H20ClN5O2/c1-4-9-11-13(18(3)17-9)19(12(16-11)8(2)14)5-6-21-7-10(15)20/h8H,4-7H2,1-3H3,(H2,15,20) |
| InChIKey | XUFPEHZPYXGXPI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|