C16H27ClN4 — CID 115326650
5-(1-chloroethyl)-3-ethyl-1-methyl-6-(5-methylhexyl)imidazo[4,5-d]pyrazole (PubChem CID 115326650) has the molecular formula C16H27ClN4 and a molecular weight of 310.87 g/mol. Its IUPAC name is 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(5-methylhexyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(5-methylhexyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 115326650 |
| Molecular Formula | C16H27ClN4 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 5-(1-chloroethyl)-3-ethyl-1-methyl-6-(5-methylhexyl)imidazo[4,5-d]pyrazole |
| SMILES | CCc1nn(C)c2c1nc(C(C)Cl)n2CCCCC(C)C |
| InChI | InChI=1S/C16H27ClN4/c1-6-13-14-16(20(5)19-13)21(15(18-14)12(4)17)10-8-7-9-11(2)3/h11-12H,6-10H2,1-5H3 |
| InChIKey | JUPLIMIKGLLXKF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|