C12H19ClN6O — CID 83115519
2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethylurea (PubChem CID 83115519) has the molecular formula C12H19ClN6O and a molecular weight of 298.78 g/mol. Its IUPAC name is 2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethylurea.
| Compound Name | 2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethylurea |
|---|---|
| PubChem CID | 83115519 |
| Molecular Formula | C12H19ClN6O |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[5-(1-chloroethyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazol-6-yl]ethylurea |
| SMILES | CCc1nn(C)c2c1nc(C(C)Cl)n2CCNC(N)=O |
| InChI | InChI=1S/C12H19ClN6O/c1-4-8-9-11(18(3)17-8)19(6-5-15-12(14)20)10(16-9)7(2)13/h7H,4-6H2,1-3H3,(H3,14,15,20) |
| InChIKey | BKZUXYYYYMZZIO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|