C12H14Cl2N4O — CID 104838601
2-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethylurea (PubChem CID 104838601) has the molecular formula C12H14Cl2N4O and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethylurea.
| Compound Name | 2-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethylurea |
|---|---|
| PubChem CID | 104838601 |
| Molecular Formula | C12H14Cl2N4O |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[4-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethylurea |
| SMILES | CC(Cl)c1nc2c(Cl)cccc2n1CCNC(N)=O |
| InChI | InChI=1S/C12H14Cl2N4O/c1-7(13)11-17-10-8(14)3-2-4-9(10)18(11)6-5-16-12(15)19/h2-4,7H,5-6H2,1H3,(H3,15,16,19) |
| InChIKey | HMFYZORHZRQDRG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|