C16H22Cl2N2 — CID 104838544
4-chloro-2-(1-chloroethyl)-1-(5-methylhexyl)benzimidazole (PubChem CID 104838544) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 4-chloro-2-(1-chloroethyl)-1-(5-methylhexyl)benzimidazole.
| Compound Name | 4-chloro-2-(1-chloroethyl)-1-(5-methylhexyl)benzimidazole |
|---|---|
| PubChem CID | 104838544 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-chloro-2-(1-chloroethyl)-1-(5-methylhexyl)benzimidazole |
| SMILES | CC(C)CCCCn1c(C(C)Cl)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C16H22Cl2N2/c1-11(2)7-4-5-10-20-14-9-6-8-13(18)15(14)19-16(20)12(3)17/h6,8-9,11-12H,4-5,7,10H2,1-3H3 |
| InChIKey | KGLBXVASQYHMFH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|