C16H24ClN3 — CID 107816942
4-chloro-1-(7-methyloctyl)benzimidazol-2-amine (PubChem CID 107816942) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is 4-chloro-1-(7-methyloctyl)benzimidazol-2-amine.
| Compound Name | 4-chloro-1-(7-methyloctyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 107816942 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 4-chloro-1-(7-methyloctyl)benzimidazol-2-amine |
| SMILES | CC(C)CCCCCCn1c(N)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C16H24ClN3/c1-12(2)8-5-3-4-6-11-20-14-10-7-9-13(17)15(14)19-16(20)18/h7,9-10,12H,3-6,8,11H2,1-2H3,(H2,18,19) |
| InChIKey | HHQAZWCKMJZHQZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|