C13H14ClN5 — CID 103008445
4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]benzimidazol-2-amine (PubChem CID 103008445) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 103008445 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-chloro-1-[2-(2-methylpyrazol-3-yl)ethyl]benzimidazol-2-amine |
| SMILES | Cn1nccc1CCn1c(N)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C13H14ClN5/c1-18-9(5-7-16-18)6-8-19-11-4-2-3-10(14)12(11)17-13(19)15/h2-5,7H,6,8H2,1H3,(H2,15,17) |
| InChIKey | GINAEJYQRATODQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |