C15H22ClN3 — CID 104836976
4-chloro-1-octan-2-ylbenzimidazol-2-amine (PubChem CID 104836976) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 4-chloro-1-octan-2-ylbenzimidazol-2-amine.
| Compound Name | 4-chloro-1-octan-2-ylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 104836976 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-chloro-1-octan-2-ylbenzimidazol-2-amine |
| SMILES | CCCCCCC(C)n1c(N)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C15H22ClN3/c1-3-4-5-6-8-11(2)19-13-10-7-9-12(16)14(13)18-15(19)17/h7,9-11H,3-6,8H2,1-2H3,(H2,17,18) |
| InChIKey | OKVJVQGTVQUXFQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|