C17H22ClN3 — CID 104719500
2-(chloromethyl)-1-octan-2-ylbenzimidazole-4-carbonitrile (PubChem CID 104719500) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 2-(chloromethyl)-1-octan-2-ylbenzimidazole-4-carbonitrile.
| Compound Name | 2-(chloromethyl)-1-octan-2-ylbenzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104719500 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-(chloromethyl)-1-octan-2-ylbenzimidazole-4-carbonitrile |
| SMILES | CCCCCCC(C)n1c(CCl)nc2c(C#N)cccc21 |
| InChI | InChI=1S/C17H22ClN3/c1-3-4-5-6-8-13(2)21-15-10-7-9-14(12-19)17(15)20-16(21)11-18/h7,9-10,13H,3-6,8,11H2,1-2H3 |
| InChIKey | DKVYQRDMGFOCHL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|