C14H18Cl2N2 — CID 104838029
4-chloro-2-(chloromethyl)-1-hexan-2-ylbenzimidazole (PubChem CID 104838029) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 4-chloro-2-(chloromethyl)-1-hexan-2-ylbenzimidazole.
| Compound Name | 4-chloro-2-(chloromethyl)-1-hexan-2-ylbenzimidazole |
|---|---|
| PubChem CID | 104838029 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-chloro-2-(chloromethyl)-1-hexan-2-ylbenzimidazole |
| SMILES | CCCCC(C)n1c(CCl)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C14H18Cl2N2/c1-3-4-6-10(2)18-12-8-5-7-11(16)14(12)17-13(18)9-15/h5,7-8,10H,3-4,6,9H2,1-2H3 |
| InChIKey | WLDAMHWSXXFOLA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|