C14H14ClN3O2 — CID 104719511
ethyl 2-[2-(chloromethyl)-4-cyanobenzimidazol-1-yl]propanoate (PubChem CID 104719511) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is ethyl 2-[2-(chloromethyl)-4-cyanobenzimidazol-1-yl]propanoate.
| Compound Name | ethyl 2-[2-(chloromethyl)-4-cyanobenzimidazol-1-yl]propanoate |
|---|---|
| PubChem CID | 104719511 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | ethyl 2-[2-(chloromethyl)-4-cyanobenzimidazol-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)n1c(CCl)nc2c(C#N)cccc21 |
| InChI | InChI=1S/C14H14ClN3O2/c1-3-20-14(19)9(2)18-11-6-4-5-10(8-16)13(11)17-12(18)7-15/h4-6,9H,3,7H2,1-2H3 |
| InChIKey | VKWBSXXYAGIKRK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|