C16H24BrN3 — CID 107816938
5-bromo-1-(7-methyloctyl)benzimidazol-2-amine (PubChem CID 107816938) has the molecular formula C16H24BrN3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 5-bromo-1-(7-methyloctyl)benzimidazol-2-amine.
| Compound Name | 5-bromo-1-(7-methyloctyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 107816938 |
| Molecular Formula | C16H24BrN3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 5-bromo-1-(7-methyloctyl)benzimidazol-2-amine |
| SMILES | CC(C)CCCCCCn1c(N)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H24BrN3/c1-12(2)7-5-3-4-6-10-20-15-9-8-13(17)11-14(15)19-16(20)18/h8-9,11-12H,3-7,10H2,1-2H3,(H2,18,19) |
| InChIKey | LWUOKRYZOYHNDY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|