C15H12BrF2N3 — CID 62616840
5-bromo-1-[2-(3,5-difluorophenyl)ethyl]benzimidazol-2-amine (PubChem CID 62616840) has the molecular formula C15H12BrF2N3 and a molecular weight of 352.18 g/mol. Its IUPAC name is 5-bromo-1-[2-(3,5-difluorophenyl)ethyl]benzimidazol-2-amine.
| Compound Name | 5-bromo-1-[2-(3,5-difluorophenyl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 62616840 |
| Molecular Formula | C15H12BrF2N3 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 5-bromo-1-[2-(3,5-difluorophenyl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Br)ccc2n1CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H12BrF2N3/c16-10-1-2-14-13(7-10)20-15(19)21(14)4-3-9-5-11(17)8-12(18)6-9/h1-2,5-8H,3-4H2,(H2,19,20) |
| InChIKey | ZTPGVDAZSHBZAP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |