C16H15F2N3 — CID 115552468
1-[2-(3,5-difluorophenyl)ethyl]-7-methylbenzimidazol-2-amine (PubChem CID 115552468) has the molecular formula C16H15F2N3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-7-methylbenzimidazol-2-amine.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-7-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 115552468 |
| Molecular Formula | C16H15F2N3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-7-methylbenzimidazol-2-amine |
| SMILES | Cc1cccc2nc(N)n(CCc3cc(F)cc(F)c3)c12 |
| InChI | InChI=1S/C16H15F2N3/c1-10-3-2-4-14-15(10)21(16(19)20-14)6-5-11-7-12(17)9-13(18)8-11/h2-4,7-9H,5-6H2,1H3,(H2,19,20) |
| InChIKey | NGILXZKTUPCGKB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |