C11H17N3 — CID 170767427
1,7-dimethylbenzimidazol-2-amine;ethane (PubChem CID 170767427) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1,7-dimethylbenzimidazol-2-amine;ethane.
| Compound Name | 1,7-dimethylbenzimidazol-2-amine;ethane |
|---|---|
| PubChem CID | 170767427 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1,7-dimethylbenzimidazol-2-amine;ethane |
| SMILES | CC.Cc1cccc2nc(N)n(C)c12 |
| InChI | InChI=1S/C9H11N3.C2H6/c1-6-4-3-5-7-8(6)12(2)9(10)11-7;1-2/h3-5H,1-2H3,(H2,10,11);1-2H3 |
| InChIKey | YTDZPEPRLJHMNR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |