C14H10Cl3N3 — CID 115552270
7-methyl-1-(2,4,5-trichlorophenyl)benzimidazol-2-amine (PubChem CID 115552270) has the molecular formula C14H10Cl3N3 and a molecular weight of 326.61 g/mol. Its IUPAC name is 7-methyl-1-(2,4,5-trichlorophenyl)benzimidazol-2-amine.
| Compound Name | 7-methyl-1-(2,4,5-trichlorophenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115552270 |
| Molecular Formula | C14H10Cl3N3 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 7-methyl-1-(2,4,5-trichlorophenyl)benzimidazol-2-amine |
| SMILES | Cc1cccc2nc(N)n(-c3cc(Cl)c(Cl)cc3Cl)c12 |
| InChI | InChI=1S/C14H10Cl3N3/c1-7-3-2-4-11-13(7)20(14(18)19-11)12-6-9(16)8(15)5-10(12)17/h2-6H,1H3,(H2,18,19) |
| InChIKey | NRJZUSSZJOREDT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|