C15H14BrN3 — CID 115552239
1-[(4-bromophenyl)methyl]-7-methylbenzimidazol-2-amine (PubChem CID 115552239) has the molecular formula C15H14BrN3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-7-methylbenzimidazol-2-amine.
| Compound Name | 1-[(4-bromophenyl)methyl]-7-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 115552239 |
| Molecular Formula | C15H14BrN3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-7-methylbenzimidazol-2-amine |
| SMILES | Cc1cccc2nc(N)n(Cc3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C15H14BrN3/c1-10-3-2-4-13-14(10)19(15(17)18-13)9-11-5-7-12(16)8-6-11/h2-8H,9H2,1H3,(H2,17,18) |
| InChIKey | BBOMLPUKKKPPRM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |