C10H9BrF3N3S — CID 106431753
5-bromo-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-2-amine (PubChem CID 106431753) has the molecular formula C10H9BrF3N3S and a molecular weight of 340.17 g/mol. Its IUPAC name is 5-bromo-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-2-amine.
| Compound Name | 5-bromo-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 106431753 |
| Molecular Formula | C10H9BrF3N3S |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 5-bromo-1-[2-(trifluoromethylsulfanyl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Br)ccc2n1CCSC(F)(F)F |
| InChI | InChI=1S/C10H9BrF3N3S/c11-6-1-2-8-7(5-6)16-9(15)17(8)3-4-18-10(12,13)14/h1-2,5H,3-4H2,(H2,15,16) |
| InChIKey | XWANWAUDBHPKNQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |