C11H11ClF3N3 — CID 115520874
5-chloro-1-(4,4,4-trifluorobutyl)benzimidazol-2-amine (PubChem CID 115520874) has the molecular formula C11H11ClF3N3 and a molecular weight of 277.68 g/mol. Its IUPAC name is 5-chloro-1-(4,4,4-trifluorobutyl)benzimidazol-2-amine.
| Compound Name | 5-chloro-1-(4,4,4-trifluorobutyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115520874 |
| Molecular Formula | C11H11ClF3N3 |
| Molecular Weight | 277.68 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-chloro-1-(4,4,4-trifluorobutyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)ccc2n1CCCC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3N3/c12-7-2-3-9-8(6-7)17-10(16)18(9)5-1-4-11(13,14)15/h2-3,6H,1,4-5H2,(H2,16,17) |
| InChIKey | JWFGTPZYIAJZSL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |