C12H14F3N3 — CID 115501979
1-butyl-5-(trifluoromethyl)benzimidazol-2-amine (PubChem CID 115501979) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 1-butyl-5-(trifluoromethyl)benzimidazol-2-amine.
| Compound Name | 1-butyl-5-(trifluoromethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115501979 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-butyl-5-(trifluoromethyl)benzimidazol-2-amine |
| SMILES | CCCCn1c(N)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C12H14F3N3/c1-2-3-6-18-10-5-4-8(12(13,14)15)7-9(10)17-11(18)16/h4-5,7H,2-3,6H2,1H3,(H2,16,17) |
| InChIKey | BKWLYFZXKIEEDF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |