C14H16F3N3O — CID 115502056
1-[2-(oxolan-2-yl)ethyl]-5-(trifluoromethyl)benzimidazol-2-amine (PubChem CID 115502056) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-[2-(oxolan-2-yl)ethyl]-5-(trifluoromethyl)benzimidazol-2-amine.
| Compound Name | 1-[2-(oxolan-2-yl)ethyl]-5-(trifluoromethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115502056 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[2-(oxolan-2-yl)ethyl]-5-(trifluoromethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(C(F)(F)F)ccc2n1CCC1CCCO1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)9-3-4-12-11(8-9)19-13(18)20(12)6-5-10-2-1-7-21-10/h3-4,8,10H,1-2,5-7H2,(H2,18,19) |
| InChIKey | LWWWQJODGGJZMF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |