C16H14F6N2O2 — CID 164631392
1-[2-[(2R)-oxolan-2-yl]ethyl]-3,7-bis(trifluoromethyl)quinoxalin-2-one (PubChem CID 164631392) has the molecular formula C16H14F6N2O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 1-[2-[(2R)-oxolan-2-yl]ethyl]-3,7-bis(trifluoromethyl)quinoxalin-2-one.
| Compound Name | 1-[2-[(2R)-oxolan-2-yl]ethyl]-3,7-bis(trifluoromethyl)quinoxalin-2-one |
|---|---|
| PubChem CID | 164631392 |
| Molecular Formula | C16H14F6N2O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-[2-[(2R)-oxolan-2-yl]ethyl]-3,7-bis(trifluoromethyl)quinoxalin-2-one |
| SMILES | O=c1c(C(F)(F)F)nc2ccc(C(F)(F)F)cc2n1CC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H14F6N2O2/c17-15(18,19)9-3-4-11-12(8-9)24(6-5-10-2-1-7-26-10)14(25)13(23-11)16(20,21)22/h3-4,8,10H,1-2,5-7H2/t10-/m1/s1 |
| InChIKey | VPUVPRPJJMTAKV-SNVBAGLBSA-N |
| XLogP | 4.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |