C13H17F3N2O2 — CID 63280433
1-[2-(oxolan-2-ylmethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 63280433) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-[2-(oxolan-2-ylmethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-(oxolan-2-ylmethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 63280433 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[2-(oxolan-2-ylmethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)cn1CCNCC1CCCO1 |
| InChI | InChI=1S/C13H17F3N2O2/c14-13(15,16)10-3-4-12(19)18(9-10)6-5-17-8-11-2-1-7-20-11/h3-4,9,11,17H,1-2,5-8H2 |
| InChIKey | CPYMQHIKSHMZIC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|