C13H21N3O3 — CID 63810079
1-ethyl-3-[2-(oxolan-2-ylmethylamino)ethyl]pyrimidine-2,4-dione (PubChem CID 63810079) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-ethyl-3-[2-(oxolan-2-ylmethylamino)ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-[2-(oxolan-2-ylmethylamino)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63810079 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-ethyl-3-[2-(oxolan-2-ylmethylamino)ethyl]pyrimidine-2,4-dione |
| SMILES | CCn1ccc(=O)n(CCNCC2CCCO2)c1=O |
| InChI | InChI=1S/C13H21N3O3/c1-2-15-7-5-12(17)16(13(15)18)8-6-14-10-11-4-3-9-19-11/h5,7,11,14H,2-4,6,8-10H2,1H3 |
| InChIKey | VPFRGBRXAHSGEG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|