C12H19N3O3 — CID 106934183
3-(2-aminoethyl)-1-[2-(oxolan-2-yl)ethyl]pyrimidine-2,4-dione (PubChem CID 106934183) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1-[2-(oxolan-2-yl)ethyl]pyrimidine-2,4-dione.
| Compound Name | 3-(2-aminoethyl)-1-[2-(oxolan-2-yl)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106934183 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-(2-aminoethyl)-1-[2-(oxolan-2-yl)ethyl]pyrimidine-2,4-dione |
| SMILES | NCCn1c(=O)ccn(CCC2CCCO2)c1=O |
| InChI | InChI=1S/C12H19N3O3/c13-5-8-15-11(16)4-7-14(12(15)17)6-3-10-2-1-9-18-10/h4,7,10H,1-3,5-6,8-9,13H2 |
| InChIKey | XYRXELZIROMRAT-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |