C13H12F3NO2 — CID 43331128
2-(oxolan-2-ylmethoxy)-5-(trifluoromethyl)benzonitrile (PubChem CID 43331128) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethoxy)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(oxolan-2-ylmethoxy)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 43331128 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-(oxolan-2-ylmethoxy)-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C13H12F3NO2/c14-13(15,16)10-3-4-12(9(6-10)7-17)19-8-11-2-1-5-18-11/h3-4,6,11H,1-2,5,8H2 |
| InChIKey | OZIBJLMOYQVMJO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |