C13H13F3N2O2 — CID 79869424
2-(oxan-2-ylmethoxy)-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 79869424) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-(oxan-2-ylmethoxy)-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(oxan-2-ylmethoxy)-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 79869424 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(oxan-2-ylmethoxy)-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1OCC1CCCCO1 |
| InChI | InChI=1S/C13H13F3N2O2/c14-13(15,16)11-5-4-9(7-17)12(18-11)20-8-10-3-1-2-6-19-10/h4-5,10H,1-3,6,8H2 |
| InChIKey | UGHGGEDKTDAWHQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |