C14H15F3N2O2S — CID 7063825
2-[1-butyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 7063825) has the molecular formula C14H15F3N2O2S and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-[1-butyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-butyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 7063825 |
| Molecular Formula | C14H15F3N2O2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[1-butyl-5-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | CCCCn1c(SCC(=O)O)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H15F3N2O2S/c1-2-3-6-19-11-5-4-9(14(15,16)17)7-10(11)18-13(19)22-8-12(20)21/h4-5,7H,2-3,6,8H2,1H3,(H,20,21) |
| InChIKey | HKZNNPXOHXDRCW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |