C14H17IN2O2S — CID 66080353
2-(5-iodo-1-pentylbenzimidazol-2-yl)sulfanylacetic acid (PubChem CID 66080353) has the molecular formula C14H17IN2O2S and a molecular weight of 404.27 g/mol. Its IUPAC name is 2-(5-iodo-1-pentylbenzimidazol-2-yl)sulfanylacetic acid.
| Compound Name | 2-(5-iodo-1-pentylbenzimidazol-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 66080353 |
| Molecular Formula | C14H17IN2O2S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 2-(5-iodo-1-pentylbenzimidazol-2-yl)sulfanylacetic acid |
| SMILES | CCCCCn1c(SCC(=O)O)nc2cc(I)ccc21 |
| InChI | InChI=1S/C14H17IN2O2S/c1-2-3-4-7-17-12-6-5-10(15)8-11(12)16-14(17)20-9-13(18)19/h5-6,8H,2-4,7,9H2,1H3,(H,18,19) |
| InChIKey | XVHIELAOQPBJBG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|