C15H19IN2O2S — CID 66079792
2-[5-iodo-1-(4-methylpentyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 66079792) has the molecular formula C15H19IN2O2S and a molecular weight of 418.30 g/mol. Its IUPAC name is 2-[5-iodo-1-(4-methylpentyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-iodo-1-(4-methylpentyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 66079792 |
| Molecular Formula | C15H19IN2O2S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 2-[5-iodo-1-(4-methylpentyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | CC(C)CCCn1c(SCC(=O)O)nc2cc(I)ccc21 |
| InChI | InChI=1S/C15H19IN2O2S/c1-10(2)4-3-7-18-13-6-5-11(16)8-12(13)17-15(18)21-9-14(19)20/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,19,20) |
| InChIKey | PCZTWBLUCAJLLZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|