C11H8F3IN2O2S — CID 66081543
2-[5-iodo-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 66081543) has the molecular formula C11H8F3IN2O2S and a molecular weight of 416.16 g/mol. Its IUPAC name is 2-[5-iodo-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-iodo-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 66081543 |
| Molecular Formula | C11H8F3IN2O2S |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 415.93 |
| IUPAC Name | 2-[5-iodo-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2cc(I)ccc2n1CC(F)(F)F |
| InChI | InChI=1S/C11H8F3IN2O2S/c12-11(13,14)5-17-8-2-1-6(15)3-7(8)16-10(17)20-4-9(18)19/h1-3H,4-5H2,(H,18,19) |
| InChIKey | RQLMQKIJSUHART-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|