C14H18ClIN2 — CID 66081071
2-(chloromethyl)-5-iodo-1-(4-methylpentyl)benzimidazole (PubChem CID 66081071) has the molecular formula C14H18ClIN2 and a molecular weight of 376.67 g/mol. Its IUPAC name is 2-(chloromethyl)-5-iodo-1-(4-methylpentyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-5-iodo-1-(4-methylpentyl)benzimidazole |
|---|---|
| PubChem CID | 66081071 |
| Molecular Formula | C14H18ClIN2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-(chloromethyl)-5-iodo-1-(4-methylpentyl)benzimidazole |
| SMILES | CC(C)CCCn1c(CCl)nc2cc(I)ccc21 |
| InChI | InChI=1S/C14H18ClIN2/c1-10(2)4-3-7-18-13-6-5-11(16)8-12(13)17-14(18)9-15/h5-6,8,10H,3-4,7,9H2,1-2H3 |
| InChIKey | JKOJQTLVNGZZNC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|